Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JNK-IN-8 is the first irreversible JNK inhibitor for JNK1, JNK2 and JNK4 with IC50 of 4.7 nM, 18.7 nM and 1 nM, respectively | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12749 |
|---|---|
| Formula | C29H29N7O2 |
| Molecular Weight | 507.59 |
| CAS Number | 1410880-22-6 |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C2=CC(=CC=C2)NC(=O)/C=C/CN(C)C)NC3=NC=CC(=N3)C4=CN=CC=C4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 91 mg/mL (179.27 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.7 mL | 98.5 mL | 197.01 mL |
| 0.5 mM | 3.94 mL | 19.7 mL | 39.4 mL |
| 1 mM | 1.97 mL | 9.85 mL | 19.7 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.94 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
