Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JZL184 is a potent and selective monoacylglycerol lipase (MAGL) inhibitor. Blocks hydrolysis of the endocannabinoid 2-arachidonyl glycerol (2-AG) in vivo in the mouse brain (IC50 = 8 nM). |
|---|
| Catalog Num | A12747 |
|---|---|
| Formula | C27H24N2O9 |
| Molecular Weight | 520.49 |
| CAS Number | 1101854-58-3 |
| SMILES | C1CN(CCC1C(C2=CC3=C(C=C2)OCO3)(C4=CC5=C(C=C4)OCO5)O)C(=O)OC6=CC=C(C=C6)[N+](=O)[O-] |
| Synonyms | JZL-184, JZL 184 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 86 mg/mL (165.22 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5%DMSO+40%PEG300+5%Tween80+ddH2O | 2.3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.21 mL | 96.06 mL | 192.13 mL |
| 0.5 mM | 3.84 mL | 19.21 mL | 38.43 mL |
| 1 mM | 1.92 mL | 9.61 mL | 19.21 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
