Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ki16425 is a LPA receptor antagonist with selectivity for LPA1 and LPA3 and exhibits Ki values of 0.34, 6.5, and 0.93 μM for the human LPA1, LPA2, and LPA3 receptors, respectively. |
|---|
| Catalog Num | A10501 |
|---|---|
| Formula | C23H23ClN2O5S |
| Molecular Weight | 475 |
| CAS Number | 355025-24-0 |
| SMILES | CC1=NOC(=C1NC(=O)OC(C)C2=CC=CC=C2Cl)C3=CC=C(C=C3)CSCCC(=O)O |
| Synonyms | Ki-16425 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 85 mg/mL (178.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 85 mg/mL (178.96 mM) | ||
| In vivo | 5% DMSO+95% Corn oil | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.05 mL | 105.26 mL | 210.53 mL |
| 0.5 mM | 4.21 mL | 21.05 mL | 42.11 mL |
| 1 mM | 2.11 mL | 10.53 mL | 21.05 mL |
| 5 mM | 0.42 mL | 2.11 mL | 4.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
