Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KS-176 is a potent and selective inhibitor of the breast cancer resistance protein (BCRP) multidrug transporter (IC50 values are 0.59 and 1.39 uM in Pheo A and Hoechst 33342 assays respectively). |
|---|
| Catalog Num | A16195 |
|---|---|
| Formula | C22H19N3O5 |
| Molecular Weight | 405.4 |
| CAS Number | 1253452-78-6 |
| SMILES | O=C(NC1=CC=C(CCO)C=C1)C2=CC=CC=C2NC(C3=CC=C([N+]([O-])=O)C=C3)=O |
| Synonyms | KS176, KS 176 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (185 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (7.4 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.67 mL | 123.33 mL | 246.67 mL |
| 0.5 mM | 4.93 mL | 24.67 mL | 49.33 mL |
| 1 mM | 2.47 mL | 12.33 mL | 24.67 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
