Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KW-2449 is a multikinase inhibitor of FLT3, ABL, ABL-T315I, and Aurora kinase. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10508 |
|---|---|
| Formula | C20H20N4O |
| Molecular Weight | 332.4 |
| CAS Number | 1000669-72-6 |
| SMILES | C1CN(CCN1)C(=O)C2=CC=C(C=C2)/C=C/C3=NNC4=CC=CC=C43 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 58 mg/mL (174.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 58 mg/mL (174.48 mM) | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.08 mL | 150.42 mL | 300.84 mL |
| 0.5 mM | 6.02 mL | 30.08 mL | 60.17 mL |
| 1 mM | 3.01 mL | 15.04 mL | 30.08 mL |
| 5 mM | 0.6 mL | 3.01 mL | 6.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
