Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lamotrigine is a novel anticonvulsant drug for inhibition of 5-HT with IC50 of 240 μM and 474 μM in human platelets and rat brain synaptosomes, and also is a sodium channel blocker. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11873 |
|---|---|
| Formula | C9H7Cl2N5 |
| Molecular Weight | 256.09 |
| CAS Number | 84057-84-1 |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(N=C(N=N2)N)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 9 mg/mL (35.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (11.71 mM) | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.05 mL | 195.24 mL | 390.49 mL |
| 0.5 mM | 7.81 mL | 39.05 mL | 78.1 mL |
| 1 mM | 3.9 mL | 19.52 mL | 39.05 mL |
| 5 mM | 0.78 mL | 3.9 mL | 7.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
