Signaling Pathway
Lapatinib is a dual tyrosine kinase inhibitor which interrupts the HER2 growth receptor pathway. Lapatinib is a potent EGFR and ErbB2 inhibitor with IC50 of 10.8 and 9.2 nM in cell-free assays, respectively. Lapatinib induces ferroptosis and autophagic cell death.
Important Notice: For research use only. We do not sell to patients.
| Discription | Lapatinib is a dual tyrosine kinase inhibitor which interrupts the HER2 growth receptor pathway. Lapatinib is a potent EGFR and ErbB2 inhibitor with IC50 of 10.8 and 9.2 nM in cell-free assays, respectively. Lapatinib induces ferroptosis and autophagic cell death. |
|||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A11752 |
|---|---|
| Formula | C29H26ClFN4O4S |
| Molecular Weight | 581.1 |
| CAS Number | 231277-92-2 |
| SMILES | CS(=O)(=O)CCNCC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 99 mg/mL (170.37 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.21 mL | 86.04 mL | 172.09 mL |
| 0.5 mM | 3.44 mL | 17.21 mL | 34.42 mL |
| 1 mM | 1.72 mL | 8.6 mL | 17.21 mL |
| 5 mM | 0.34 mL | 1.72 mL | 3.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
