Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Lappaconite Hydrobromide is a kind of alkaloid extracted from Aconitum sinomontanum Nakai and has anti-inflammatory effects. |
|---|
| Catalog Num | A10515 |
|---|---|
| Formula | C32H44N2O8.HBr |
| Molecular Weight | 665.6 |
| CAS Number | 97792-45-5 |
| SMILES | CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2C[C@@H](C31)[C@]5(C[C@@H]([C@H]6C[C@@H]4[C@@]5([C@H]6OC)O)OC)O)OC)OC(=O)C7=CC=CC=C7NC(=O)C.Br |
| Synonyms | Allapinine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 26 mg/mL (39.06 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.02 mL | 75.12 mL | 150.24 mL |
| 0.5 mM | 3 mL | 15.02 mL | 30.05 mL |
| 1 mM | 1.5 mL | 7.51 mL | 15.02 mL |
| 5 mM | 0.3 mL | 1.5 mL | 3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
