Loading distributor info...
| Description | Levamisole hydrochloride is an anthelmintic and immunomodulator belonging to a class of synthetic imidazothiazole derivatives. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10525 |
|---|---|
| Formula | C11H13ClN2S |
| Molecular Weight | 240.75 |
| CAS Number | 16595-80-5 |
| SMILES | [H]Cl.C12=N[C@@H](C3=CC=CC=C3)CN1CCS2 |
| Synonyms | (-)-Tetramisole hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 45 mg/mL (186.91 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.54 mL | 207.68 mL | 415.37 mL |
| 0.5 mM | 8.31 mL | 41.54 mL | 83.07 mL |
| 1 mM | 4.15 mL | 20.77 mL | 41.54 mL |
| 5 mM | 0.83 mL | 4.15 mL | 8.31 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
