Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Linezolid is a synthetic antibiotic used for the treatment of serious infections. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10533 |
|---|---|
| Formula | C16H20FN3O4 |
| Molecular Weight | 337.3 |
| CAS Number | 165800-03-3 |
| SMILES | CC(=O)NC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F |
| Synonyms | Zyvox, U-100766, Zyvoxid, Zyvoxam |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 62 mg/mL (183.78 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (20.75 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.65 mL | 148.24 mL | 296.47 mL |
| 0.5 mM | 5.93 mL | 29.65 mL | 59.29 mL |
| 1 mM | 2.96 mL | 14.82 mL | 29.65 mL |
| 5 mM | 0.59 mL | 2.96 mL | 5.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
