Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Longdaysin is a inhibitor of the Wnt/β-catenin signaling pathway, which exerts antitumor effect through blocking CK1δ/ε-dependent Wnt signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21022 |
|---|---|
| Formula | C16H16F3N5 |
| Molecular Weight | 335.33 |
| CAS Number | 1353867-91-0 |
| SMILES | FC(F)(F)C1=CC=CC(CNC2=NC=NC3=C2N=CN3C(C)C)=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (196.82 mM) | |
| Water | Insoluble | ||
| Ethanol | 66 mg/mL (196.82 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.82 mL | 149.11 mL | 298.21 mL |
| 0.5 mM | 5.96 mL | 29.82 mL | 59.64 mL |
| 1 mM | 2.98 mL | 14.91 mL | 29.82 mL |
| 5 mM | 0.6 mL | 2.98 mL | 5.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
