Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY2119620 is a specific, and allosteric agonist of human M2 and M4 muscarinic acetylcholine receptors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14217 |
|---|---|
| Formula | C19H24ClN5O3S |
| Molecular Weight | 437.94 |
| CAS Number | 886047-22-9 |
| SMILES | CC1=C2C(=C(SC2=NC(=C1Cl)OCC(=O)N3CCN(CC3)C)C(=O)NC4CC4)N |
| Synonyms | LY 2119620, LY-2219620 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (175.82 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 9 mg/mL (20.55 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.83 mL | 114.17 mL | 228.34 mL |
| 0.5 mM | 4.57 mL | 22.83 mL | 45.67 mL |
| 1 mM | 2.28 mL | 11.42 mL | 22.83 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
