Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY2228820 is a novel and potent p38MAPK inhibitor with potent antiinflammatory activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10545 |
|---|---|
| Formula | C24H29FN6.2CH4O3S |
| Molecular Weight | 612.7 |
| CAS Number | 862507-23-1 |
| SMILES | CC(C)(C)CN1C2=C(C=CC(=N2)C3=C(N=C(N3)C(C)(C)C)C4=CC=C(C=C4)F)N=C1N.CS(=O)(=O)O.CS(=O)(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 4 mg/mL (6.52 mM) | |
| Water | Warmed: 91 mg/mL (148.51 mM) | ||
| Ethanol | 3 mg/mL (4.89 mM) | ||
| In vivo | Saline | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.32 mL | 81.61 mL | 163.21 mL |
| 0.5 mM | 3.26 mL | 16.32 mL | 32.64 mL |
| 1 mM | 1.63 mL | 8.16 mL | 16.32 mL |
| 5 mM | 0.33 mL | 1.63 mL | 3.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
