Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY364947 is a diheteroaryl-substituted pyrazole compound used as a selective, ATP-competitive inhibitor of TGF-βRI (TGF-β Receptor I kinase). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13446 |
|---|---|
| Formula | C17H12N4 |
| Molecular Weight | 272.3 |
| CAS Number | 396129-53-6 |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)C3=C(NN=C3)C4=CC=CC=N4 |
| Synonyms | HTS 466284 ,TGF-β RI Kinase Inhibitor |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 1 mg/mL (3.67 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 0.71 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.72 mL | 183.62 mL | 367.24 mL |
| 0.5 mM | 7.34 mL | 36.72 mL | 73.45 mL |
| 1 mM | 3.67 mL | 18.36 mL | 36.72 mL |
| 5 mM | 0.73 mL | 3.67 mL | 7.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
