Signaling Pathway
Macozinone (PBTZ169) is a bactericidal benzothiazinone and a potent DprE1 (decaprenylphosphoryl-β-d-ribose 2'-oxidase) inhibitor.
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Macozinone (PBTZ169) is a bactericidal benzothiazinone and a potent DprE1 (decaprenylphosphoryl-β-d-ribose 2'-oxidase) inhibitor. |
|---|
| Catalog Num | A21488 |
|---|---|
| Formula | C20H23F3N4O3S |
| Molecular Weight | 456.48 |
| CAS Number | 1377239-83-2 |
| SMILES | O=C1C2=CC(C(F)(F)F)=CC([N+]([O-])=O)=C2SC(N3CCN(CC4CCCCC4)CC3)=N1 |
| Synonyms | PBTZ169, PBTZ 169, PBTZ-169 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (10.95 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (8.76 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.91 mL | 109.53 mL | 219.07 mL |
| 0.5 mM | 4.38 mL | 21.91 mL | 43.81 mL |
| 1 mM | 2.19 mL | 10.95 mL | 21.91 mL |
| 5 mM | 0.44 mL | 2.19 mL | 4.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
