Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Magnolol (2,2'-Bichavicol) is a bioactive compound found in the bark of the Houpu magnolia (Magnolia officinalis). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10551 |
|---|---|
| Formula | C18H18O2 |
| Molecular Weight | 266.3 |
| CAS Number | 528-43-8 |
| SMILES | C=CCC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)CC=C)O |
| Synonyms | 2,2'-Bichavicol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (172.72 mM) | |
| Water | Insoluble | ||
| Ethanol | 46 mg/mL (172.72 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.55 mL | 187.76 mL | 375.52 mL |
| 0.5 mM | 7.51 mL | 37.55 mL | 75.1 mL |
| 1 mM | 3.76 mL | 18.78 mL | 37.55 mL |
| 5 mM | 0.75 mL | 3.76 mL | 7.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
