Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Manidipine 2HCl is a HCl salt form of Manidipine which is a calcium channel blocker for Ca2+ current with IC50 of 2.6 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10554 |
|---|---|
| Formula | C35H40Cl2N4O6 |
| Molecular Weight | 683.6 |
| CAS Number | 89226-75-5 |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCN2CCN(CC2)C(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC(=CC=C5)[N+](=O)[O-])C(=O)OC.Cl.Cl |
| Synonyms | CV-4093 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 19 mg/mL (27.79 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.63 mL | 73.14 mL | 146.28 mL |
| 0.5 mM | 2.93 mL | 14.63 mL | 29.26 mL |
| 1 mM | 1.46 mL | 7.31 mL | 14.63 mL |
| 5 mM | 0.29 mL | 1.46 mL | 2.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
