Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Maraviroc is an antiretroviral drug in the CCR5 receptor antagonist class used in the treatment of HIV infection. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10556 |
|---|---|
| Formula | C29H41F2N5O |
| Molecular Weight | 513.7 |
| CAS Number | 376348-65-1 |
| SMILES | CC1=NN=C(N1C2C[C@H]3CC[C@@H](C2)N3CC[C@@H](C4=CC=CC=C4)NC(=O)C5CCC(CC5)(F)F)C(C)C |
| Synonyms | Celsentri |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 91 mg/mL (177.15 mM) | |
| Water | Insoluble | ||
| Ethanol | 91 mg/mL (177.15 mM) | ||
| In vivo | 2% DMSO+corn oil | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.47 mL | 97.33 mL | 194.67 mL |
| 0.5 mM | 3.89 mL | 19.47 mL | 38.93 mL |
| 1 mM | 1.95 mL | 9.73 mL | 19.47 mL |
| 5 mM | 0.39 mL | 1.95 mL | 3.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
