Marimastat
Marimastat acted as a broad-spectrum matrix metalloproteinase inhibitor.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Marimastat acted as a broad-spectrum matrix metalloproteinase inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12826 |
|---|---|
| Formula | C15H29N3O5 |
| Molecular Weight | 331.41 |
| CAS Number | 154039-60-8 |
| SMILES | CC(C)C[C@H]([C@@H](C(=O)NO)O)C(=O)N[C@H](C(=O)NC)C(C)(C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 46 mg/mL (138.8 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 6 mg/mL (18.1 mM) | ||
| In vivo | 50% DMSO+PBS | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.17 mL | 150.87 mL | 301.74 mL |
| 0.5 mM | 6.03 mL | 30.17 mL | 60.35 mL |
| 1 mM | 3.02 mL | 15.09 mL | 30.17 mL |
| 5 mM | 0.6 mL | 3.02 mL | 6.03 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2