Loading distributor info...
| Description | Mebendazole is a highly effective, broad-spectrum antihelmintic indicated for the treatment of nematode infestations; has been found as a hedgehog inhibitor. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16606 |
|---|---|
| Formula | C16H13N3O3 |
| Molecular Weight | 295.29 |
| CAS Number | 31431-39-7 |
| SMILES | O=C(OC)NC1=NC2=CC=C(C(C3=CC=CC=C3)=O)C=C2N1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (16.93 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.87 mL | 169.33 mL | 338.65 mL |
| 0.5 mM | 6.77 mL | 33.87 mL | 67.73 mL |
| 1 mM | 3.39 mL | 16.93 mL | 33.87 mL |
| 5 mM | 0.68 mL | 3.39 mL | 6.77 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
