Loading distributor info...
| Description | Methacholine chloride is a synthetic choline ester that acts as a non-selective muscarinic receptor agonist in the parasympathetic nervous system. |
|---|
| Catalog Num | A17285 |
|---|---|
| Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 |
| CAS Number | 62-51-1 |
| SMILES | CC(C[N+](C)(C)C)OC(=O)C.[Cl-] |
| Synonyms | Methacholine Chloride; Acetyl-beta-methylcholine chloride; Provocholine; Mecholyl chloride; Amechol; Methapharma Brand of Methacholine Chloride; Provocholine; Provokit; Roche Brand of Methacholine Chloride; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (189.07 mM) | |
| Water | 37 mg/mL (189.07 mM) | ||
| Ethanol | 37 mg/mL (189.07 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 51.1 mL | 255.51 mL | 511.01 mL |
| 0.5 mM | 10.22 mL | 51.1 mL | 102.2 mL |
| 1 mM | 5.11 mL | 25.55 mL | 51.1 mL |
| 5 mM | 1.02 mL | 5.11 mL | 10.22 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
