Loading distributor info...
| Description | Meticrane is a diuretic. Meticrane inhibits the reabsorption of sodium and chloride ions in the distal convoluted tubule. Meticrane is used to treat essential hypertension. |
|---|
| Catalog Num | A17366 |
|---|---|
| Formula | C10H13NO4S2 |
| Molecular Weight | 275.34 |
| CAS Number | 1084-65-7 |
| SMILES | O=S(C1=C(C)C=C(C2=C1)CCCS2(=O)=O)(N)=O |
| Synonyms | Meticrane |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (192.49 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.32 mL | 181.59 mL | 363.19 mL |
| 0.5 mM | 7.26 mL | 36.32 mL | 72.64 mL |
| 1 mM | 3.63 mL | 18.16 mL | 36.32 mL |
| 5 mM | 0.73 mL | 3.63 mL | 7.26 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
