Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MG-101 (ALLN) is a cell-permeable and potent inhibitor of cysteine proteases including calpains and lysosomal cathepsins. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14220 |
|---|---|
| Formula | C20H37N3O4 |
| Molecular Weight | 383.53 |
| CAS Number | 110044-82-1 |
| SMILES | CCCCC(C=O)NC(=O)C(CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)C |
| Synonyms | ALLN |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (169.47 mM) | |
| Water | Insoluble | ||
| Ethanol | 65 mg/mL (169.47 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.07 mL | 130.37 mL | 260.74 mL |
| 0.5 mM | 5.21 mL | 26.07 mL | 52.15 mL |
| 1 mM | 2.61 mL | 13.04 mL | 26.07 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
