Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Mirogabalin (DS-5565) is a novel, preferentially selective α2δ-1 ligand characterized by high potency and selectivity to the α2δ-1 subunit of voltage-sensitive calcium channel complexes in the CNS. |
|---|
| Catalog Num | A21626 |
|---|---|
| Formula | C12H19NO2 |
| Molecular Weight | 209.28 |
| CAS Number | 1138245-13-2 |
| SMILES | O=C(O)C[C@]1(CN)[C@]2([H])C=C(CC)C[C@]2([H])C1 |
| Synonyms | DS5565, DS 5565, DS-5565 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 2 mg/mL (9.55 mM) | |
| Water | 3 mg/mL (14.33 mM) | ||
| Ethanol | 2 mg/mL (9.55 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 47.78 mL | 238.91 mL | 477.83 mL |
| 0.5 mM | 9.56 mL | 47.78 mL | 95.57 mL |
| 1 mM | 4.78 mL | 23.89 mL | 47.78 mL |
| 5 mM | 0.96 mL | 4.78 mL | 9.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
