Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MK-2048 is a second generation integrase inhibitor, intended to be used against HIV infection. |
|---|
| Catalog Num | A11135 |
|---|---|
| Formula | C21H21ClFN5O4 |
| Molecular Weight | 461.9 |
| CAS Number | 869901-69-9 |
| SMILES | CCN1C[C@@H](N2C3=C(C(=C2C1=O)O)C(=O)N(N=C3C(=O)NC)CC4=CC(=C(C=C4)F)Cl)C |
| Synonyms | MK2048 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (19.48 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.65 mL | 108.25 mL | 216.5 mL |
| 0.5 mM | 4.33 mL | 21.65 mL | 43.3 mL |
| 1 mM | 2.16 mL | 10.82 mL | 21.65 mL |
| 5 mM | 0.43 mL | 2.16 mL | 4.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
