Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MK-3903 is a potent and selective AMPK activator (EC50 = 8 nM). MK-3903 exhibited robust target engagement in mouse liver following oral dosing, leading to improved lipid metabolism and insulin sensitization in mice. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17063 |
|---|---|
| Formula | C27H19ClN2O3 |
| Molecular Weight | 454.91 |
| CAS Number | 1219737-12-8 |
| SMILES | O=C(O)C1=CC(OC2=NC3=CC(C4=CC=C(C5=CC=CC=C5)C=C4)=C(Cl)C=C3N2)=CC=C1C |
| Synonyms | MK3903, MK 3903 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (180.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.98 mL | 109.91 mL | 219.82 mL |
| 0.5 mM | 4.4 mL | 21.98 mL | 43.96 mL |
| 1 mM | 2.2 mL | 10.99 mL | 21.98 mL |
| 5 mM | 0.44 mL | 2.2 mL | 4.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
