Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | MLN1117, also known as INK1117 and TAK-117, is an orally bioavailable inhibitor of the class I phosphoinositide 3-kinase (PI3K) alpha isoform with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15529 |
|---|---|
| Formula | C19H17N5O3 |
| Molecular Weight | 363.13 |
| CAS Number | 1268454-23-4 |
| SMILES | O=C(C1=CN=C2C=CC(C3=CC=C(OC(N)=N4)C4=C3)=CN21)N5CCOCC5 |
| Synonyms | INK1117, INK-1117, INK 1117, MLN 1117, MLN-1117, TAK-117, TAK 117, TAK117 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 15 mg/mL (41.28 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.54 mL | 137.69 mL | 275.38 mL |
| 0.5 mM | 5.51 mL | 27.54 mL | 55.08 mL |
| 1 mM | 2.75 mL | 13.77 mL | 27.54 mL |
| 5 mM | 0.55 mL | 2.75 mL | 5.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
