Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MRT68921 is a potent and dual autophagy kinase ULK1/2 inhibitor with IC50 of 2.9 nM and 1.1 nM, respectively. |
|---|
| Catalog Num | A15880 |
|---|---|
| Formula | C27H38Cl2N4O |
| Molecular Weight | 505.5 |
| CAS Number | 1190379-70-4 |
| SMILES | CN1CCC2=C(C1)C=CC(=C2)NC3=CC(=C(C=C3)C4CC4)NCCCNC(=O)C5CCC5.Cl.Cl |
| Synonyms | MRT67307 HCl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.78 mL | 98.91 mL | 197.82 mL |
| 0.5 mM | 3.96 mL | 19.78 mL | 39.56 mL |
| 1 mM | 1.98 mL | 9.89 mL | 19.78 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
