Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Nafamostat is an anticoagulant. Broad spectrum serine protease inhibitor. Reduces eosinophil infiltration, mast cell activation and airway responsiveness in a murine model of asthma. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10617 |
|---|---|
| Formula | C19H17N5O2.2CH4O3S |
| Molecular Weight | 539.6 |
| CAS Number | 82956-11-4 |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1=CC(=CC=C1C(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=N)N)N=C(N)N |
| Synonyms | Futhan, FUT-175 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 17 mg/mL (31.5 mM) | |
| Water | 46 mg/mL (85.25 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.53 mL | 92.66 mL | 185.32 mL |
| 0.5 mM | 3.71 mL | 18.53 mL | 37.06 mL |
| 1 mM | 1.85 mL | 9.27 mL | 18.53 mL |
| 5 mM | 0.37 mL | 1.85 mL | 3.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
