Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nelarabine is a purine nucleoside analog converted to its corresponding arabinosylguanine nucleotide triphosphate (araGTP), resulting in inhibition of DNA synthesis and cytotoxicity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10632 |
|---|---|
| Formula | C11H15N5O5 |
| Molecular Weight | 297.3 |
| CAS Number | 121032-29-9 |
| SMILES | COC1=NC(=NC2=C1N=CN2[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N |
| Synonyms | 506U78 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 55 mg/mL (185.01 mM) | |
| Water | 3 mg/mL (10.09 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | saline | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.64 mL | 168.18 mL | 336.36 mL |
| 0.5 mM | 6.73 mL | 33.64 mL | 67.27 mL |
| 1 mM | 3.36 mL | 16.82 mL | 33.64 mL |
| 5 mM | 0.67 mL | 3.36 mL | 6.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
