Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nicardipine hydrochloride (YC-93) is a calcium channel blocker with an IC50 of 1 μM for blocking cardiac calcium channels. |
|---|
| Catalog Num | A16634 |
|---|---|
| Formula | C26H30ClN3O6 |
| Molecular Weight | 515.99 |
| CAS Number | 54527-84-3 |
| SMILES | O=C(C1=C(C)NC(C)=C(C(OCCN(C)CC2=CC=CC=C2)=O)C1C3=CC=CC([N+]([O-])=O)=C3)OC.[H]Cl |
| Synonyms | YC-93 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (170.54 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.38 mL | 96.9 mL | 193.8 mL |
| 0.5 mM | 3.88 mL | 19.38 mL | 38.76 mL |
| 1 mM | 1.94 mL | 9.69 mL | 19.38 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
