Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nigericin sodium salt is an antibiotic from Streptomyces hygroscopicus that works by acting as an H+, K+, and Pb2+ ionophore, a NLRP3 activator. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20681 |
|---|---|
| Formula | C40H67NaO11 |
| Molecular Weight | 746.94 |
| CAS Number | 28643-80-3 |
| SMILES | C[C@H]1[C@](O[C@@H]2C[C@](CC[C@@H]3C)([H])O[C@@]3([H])[C@@H](C)C([O-])=O)([C@@H]([C@H](OC)C2)C)O[C@](C)([C@]4([H])O[C@](C)([C@]5([H])O[C@]([C@@]([C@H](C[C@H]6C)C)([H])O[C@@]6(O)CO)([H])C[C@@H]5C)CC4)C1.[Na+] |
| Synonyms | Sodium Nigericin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | 86 mg/mL (115.13 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 13.39 mL | 66.94 mL | 133.88 mL |
| 0.5 mM | 2.68 mL | 13.39 mL | 26.78 mL |
| 1 mM | 1.34 mL | 6.69 mL | 13.39 mL |
| 5 mM | 0.27 mL | 1.34 mL | 2.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
