Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Nilvadipine is a calcium channel blocker (CCB) used for the treatment of hypertension and chronic major cerebral artery occlusion | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11731 |
|---|---|
| Formula | C19H19N3O6 |
| Molecular Weight | 385.37 |
| CAS Number | 75530-68-6 |
| SMILES | CC1=C(C(C(=C(N1)C#N)C(=O)OC)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC(C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (173.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 29 mg/mL (75.25 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.95 mL | 129.75 mL | 259.49 mL |
| 0.5 mM | 5.19 mL | 25.95 mL | 51.9 mL |
| 1 mM | 2.59 mL | 12.97 mL | 25.95 mL |
| 5 mM | 0.52 mL | 2.59 mL | 5.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
