Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nitenpyram is a nicotinic acetylcholine receptor (AchR) agonist. |
|---|
| Catalog Num | A14229 |
|---|---|
| Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 |
| CAS Number | 150824-47-8 |
| SMILES | CCN(CC1=CN=C(C=C1)Cl)/C(=C/[N+](=O)[O-])/NC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (184.69 mM) | |
| Water | Warmed: 50 mg/mL (184.69 mM) | ||
| Ethanol | 50 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.94 mL | 184.69 mL | 369.39 mL |
| 0.5 mM | 7.39 mL | 36.94 mL | 73.88 mL |
| 1 mM | 3.69 mL | 18.47 mL | 36.94 mL |
| 5 mM | 0.74 mL | 3.69 mL | 7.39 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
