Loading distributor info...
| Description | Nitidine chloride, a natural benzophenanthridine alkaloid, has been shown to inhibit cancer growth via induction of cell apoptosis and suppression of cancer angiogenesis. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A14701 |
|---|---|
| Formula | C21H18ClNO4 |
| Molecular Weight | 383.82 |
| CAS Number | 13063-04-2 |
| SMILES | C[N+]1=CC2=CC(=C(C=C2C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC)OC.[Cl-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 10 mg/mL (26.05 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.05 mL | 130.27 mL | 260.54 mL |
| 0.5 mM | 5.21 mL | 26.05 mL | 52.11 mL |
| 1 mM | 2.61 mL | 13.03 mL | 26.05 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.21 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
