Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nodinitib-1 (ML130;CID-1088438) is a NOD1 inhibitor with an IC50 of 0.56 μM. |
|---|
| Catalog Num | A16619 |
|---|---|
| Formula | C14H13N3O2S |
| Molecular Weight | 287.34 |
| CAS Number | 799264-47-4 |
| SMILES | NC1=NC2=CC=CC=C2N1S(=O)(C3=CC=C(C)C=C3)=O |
| Synonyms | ML-130, ML 130, ML130; CID1088438, CID 1088438, CID-1088438 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (180.97 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.8 mL | 174.01 mL | 348.02 mL |
| 0.5 mM | 6.96 mL | 34.8 mL | 69.6 mL |
| 1 mM | 3.48 mL | 17.4 mL | 34.8 mL |
| 5 mM | 0.7 mL | 3.48 mL | 6.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
