Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | O-304 is a first-in-class, orally available pan-AMPK activator, which increases AMPK activity by suppressing the dephosphorylation of pAMPK. |
|---|
| Catalog Num | A19807 |
|---|---|
| Formula | C16H11Cl2N3O2S |
| Molecular Weight | 380.25 |
| CAS Number | 1261289-04-6 |
| SMILES | O=C(NC(SN1CC2=CC=C(Cl)C=C2)=NC1=O)C3=CC=C(Cl)C=C3 |
| Synonyms | O 304; O304 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 19 mg/mL (49.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.3 mL | 131.49 mL | 262.98 mL |
| 0.5 mM | 5.26 mL | 26.3 mL | 52.6 mL |
| 1 mM | 2.63 mL | 13.15 mL | 26.3 mL |
| 5 mM | 0.53 mL | 2.63 mL | 5.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
