Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | OAC1 enhances iPSC reprogramming efficiency by enhancing Oct4 and Nanog driven gene expression. |
|---|
| Catalog Num | A12931 |
|---|---|
| Formula | C14H11N3O |
| Molecular Weight | 237.26 |
| CAS Number | 300586-90-7 |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=NC=C3C(=C2)C=CN3 |
| Synonyms | OAC-1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (177.02 mM) | |
| Water | Insoluble | ||
| Ethanol | 19 mg/mL (80.08 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.15 mL | 210.74 mL | 421.48 mL |
| 0.5 mM | 8.43 mL | 42.15 mL | 84.3 mL |
| 1 mM | 4.21 mL | 21.07 mL | 42.15 mL |
| 5 mM | 0.84 mL | 4.21 mL | 8.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
