Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Ozagrel is an antiplatelet agent working as a thromboxane A2 synthesis inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11742 |
|---|---|
| Formula | C13H12N2O2.HCl |
| Molecular Weight | 264.7 |
| CAS Number | 78712-43-3 |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)/C=C/C(=O)O.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (170 mM) | |
| Water | 45 mg/mL (170 mM) | ||
| Ethanol | 5 mg/mL (18.88 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.78 mL | 188.89 mL | 377.79 mL |
| 0.5 mM | 7.56 mL | 37.78 mL | 75.56 mL |
| 1 mM | 3.78 mL | 18.89 mL | 37.78 mL |
| 5 mM | 0.76 mL | 3.78 mL | 7.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
