Loading distributor info...
| Description | (-)-p-Bromotetramisole Oxalate is a potent and non-specific alkaline phosphatase inhibitor. |
|---|
| Catalog Num | A14271 |
|---|---|
| Formula | C13H13BrN2O4S |
| Molecular Weight | 373.22 |
| CAS Number | 62284-79-1 |
| SMILES | C1CSC2=N[C@H](CN21)C3=CC=C(C=C3)Br.C(=O)(C(=O)O)O |
| Synonyms | L-p-Bromotetramisole Oxalate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (179.51 mM) | |
| Water | Warmed: 27 mg/mL (72.34 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.79 mL | 133.97 mL | 267.94 mL |
| 0.5 mM | 5.36 mL | 26.79 mL | 53.59 mL |
| 1 mM | 2.68 mL | 13.4 mL | 26.79 mL |
| 5 mM | 0.54 mL | 2.68 mL | 5.36 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
