Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | P110δ-IN-1 is a potent and selective inhibitor of P110δ extracted from patent WO 2014055647 A1, with an IC50 of 8.4 nM. |
|---|
| Catalog Num | A18348 |
|---|---|
| Formula | C31H40N8O3S |
| Molecular Weight | 604.774 |
| CAS Number | 1595129-71-7 |
| SMILES | O=S(C1=NC2=CC=CC=C2N1C3=NC(N4CCOCC4)=NC(NC(C)(C)CC5=CC=CC=C5C6CCN(C)CC6)=N3)(C)=O |
| Synonyms | ME401, ME 401, PWT143, PWT 143, PWT-143 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 18 mg/mL (29.76 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.54 mL | 82.68 mL | 165.35 mL |
| 0.5 mM | 3.31 mL | 16.54 mL | 33.07 mL |
| 1 mM | 1.65 mL | 8.27 mL | 16.54 mL |
| 5 mM | 0.33 mL | 1.65 mL | 3.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
