Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-04418948 is a potent and selective prostaglandin EP2 receptor antagonist with IC50 of 16 nM. Phase 1. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12894 |
|---|---|
| Formula | C23H20FNO5 |
| Molecular Weight | 409.41 |
| CAS Number | 1078166-57-0 |
| SMILES | O=C(C1(COC2=CC=C3C=C(OC)C=CC3=C2)CN(C(C4=CC=C(C=C4)F)=O)C1)O |
| Synonyms | PF04418948, PF 04418948 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (195.4 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.43 mL | 122.13 mL | 244.25 mL |
| 0.5 mM | 4.89 mL | 24.43 mL | 48.85 mL |
| 1 mM | 2.44 mL | 12.21 mL | 24.43 mL |
| 5 mM | 0.49 mL | 2.44 mL | 4.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
