Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-06700841 is an inhibitor of JAK1 and TYK2 kinases. CAS: 1883299-62-4 (free base) | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17176 |
|---|---|
| Formula | C25H29F2N7O4S |
| Molecular Weight | 561.61 |
| CAS Number | 1883299-62-4 |
| SMILES | O=C([C@H]1C(F)(F)C1)N2C3CN(C4=NC(NC5=CN(C)N=C5)=NC=C4)CC2CC3.OS(=O)(C6=CC=C(C)C=C6)=O |
| Synonyms | PF06700841, PF 06700841 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (190.03 mM) | |
| Water | Insoluble | ||
| Ethanol | 74 mg/mL (190.03 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.81 mL | 89.03 mL | 178.06 mL |
| 0.5 mM | 3.56 mL | 17.81 mL | 35.61 mL |
| 1 mM | 1.78 mL | 8.9 mL | 17.81 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
