Loading distributor info...
| Description | PF-4989216 is a potent and selective PI3K inhibitor with IC50 of 2 nM, 142 nM, 65 nM, 1 nM, and 110 nM for p110α, p110β, p110γ, p110δ, and VPS34, respectively. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12889 |
|---|---|
| Formula | C18H13FN6OS |
| Molecular Weight | 380.4 |
| CAS Number | 1276553-09-3 |
| SMILES | C1COCCN1C2=C(C(=C(S2)C3=NC=NN3)C4=C(C=C(C=C4)C#N)F)C#N |
| Synonyms | PF4989216, PF 4989216 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 66 mg/mL (173.49 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 6 mg/mL (15.77 mM) | ||
| In vivo | Suspended in 0.5% methylcellulose | 1 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.29 mL | 131.44 mL | 262.88 mL |
| 0.5 mM | 5.26 mL | 26.29 mL | 52.58 mL |
| 1 mM | 2.63 mL | 13.14 mL | 26.29 mL |
| 5 mM | 0.53 mL | 2.63 mL | 5.26 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
