Loading distributor info...
| Description | PF-5274857 is a novel Smo antagonist that specifically binds to Smo with a K(i) of 4.6 ?? 1.1 nmol/L and completely blocks the transcriptional activity of the downstream gene Gli1 with an IC(50) of 2.7 ?? 1.4 nmol/L in cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12775 |
|---|---|
| Formula | C20H25ClN4O3S |
| Molecular Weight | 436.96 |
| CAS Number | 1373615-35-0 |
| SMILES | CC1=CC(=C(N=C1)C2=CC(=NC=C2Cl)N3CCN(CC3)C(=O)CCS(=O)(=O)C)C |
| Synonyms | PF5274857, PF 5274857 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 83 mg/mL (189.95 mM) | |
| Water | 83 mg/mL (189.95 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | Saline | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.89 mL | 114.43 mL | 228.85 mL |
| 0.5 mM | 4.58 mL | 22.89 mL | 45.77 mL |
| 1 mM | 2.29 mL | 11.44 mL | 22.89 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.58 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
