Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-06260933 is a potent, selective, orally available MAP4K4 inhibitor with IC50 of 3.7 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18326 |
|---|---|
| Formula | C16H13ClN4 |
| Molecular Weight | 296.75 |
| CAS Number | 1811510-56-1 |
| SMILES | NC1=C(C2=CC=C(Cl)C=C2)C=C(C3=CC=C(N)N=C3)C=N1 |
| Synonyms | PF6260933, PF 6260933 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (175.23 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.7 mL | 168.49 mL | 336.98 mL |
| 0.5 mM | 6.74 mL | 33.7 mL | 67.4 mL |
| 1 mM | 3.37 mL | 16.85 mL | 33.7 mL |
| 5 mM | 0.67 mL | 3.37 mL | 6.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
