Ph-Bis(C1-N-(C2-NH-Boc)2) is a PROTAC linker designed for enhanced protein degradation through targeted protein removal. Its alkyl chain structure facilitates efficient conjugation with ligands and E3 ligases, enabling the development of effective PROTACs. This compound is essential for researchers investigating targeted protein degradation and interrogating cellular mechanisms associated with protein homeostasis.
Ph-Bis(C1-N-(C2-NH-Boc)2) is a PROTAC linker designed for enhanced protein degradation through targeted protein removal. Its alkyl chain structure facilitates efficient conjugation with ligands and E3 ligases, enabling the development of effective PROTACs. This compound is essential for researchers investigating targeted protein degradation and interrogating cellular mechanisms associated with protein homeostasis.
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
