Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Piperlongumine selectively kills cancer cells regardless of p53 status without harming normal cells. It binds to and inihbits proteins known to regulate oxidative stress, in particular, Glutathione S-transferase pi 1 (GSTP1). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14124 |
|---|---|
| Formula | C17H19NO5 |
| Molecular Weight | 317.3 |
| CAS Number | 20069-09-4 |
| SMILES | COC1=CC(=CC(=C1OC)OC)C=CC(=O)N2CCC=CC2=O |
| Synonyms | Piplartine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 15 mg/mL (47.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 6 mg/mL (18.9 mM) | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.52 mL | 157.58 mL | 315.16 mL |
| 0.5 mM | 6.3 mL | 31.52 mL | 63.03 mL |
| 1 mM | 3.15 mL | 15.76 mL | 31.52 mL |
| 5 mM | 0.63 mL | 3.15 mL | 6.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
