Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Piperonyl butoxide (PBO) is an organic compound used as a component of pesticide formulations. |
|---|
| Catalog Num | A17429 |
|---|---|
| Formula | C19H30O5 |
| Molecular Weight | 338.44 |
| CAS Number | CAS: 51-03-6 |
| SMILES | CCCC1=C(COCCOCCOCCCC)C=C2OCOC2=C1 |
| Synonyms | Piperonyl butoxide; NSC 8401; NSC-8401; NSC8401 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (195.01 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.55 mL | 147.74 mL | 295.47 mL |
| 0.5 mM | 5.91 mL | 29.55 mL | 59.09 mL |
| 1 mM | 2.95 mL | 14.77 mL | 29.55 mL |
| 5 mM | 0.59 mL | 2.95 mL | 5.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
