Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PKC 412 is a broad spectrum protein kinase inhibitor. Inhibits conventional PKC isoforms α/β/γ, PDFRβ, VEGFR2, Syk, Flk-1, Flt3, Cdk1/B, PKA, c-Kit, c-Fgr, c-Src, VEGFR1 and EGFR. Displays potent antitumor activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12650 |
|---|---|
| Formula | C35H30N4O4 |
| Molecular Weight | 570.64 |
| CAS Number | 120685-11-2 |
| SMILES | C[C@@]12[C@@H]([C@@H](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)N(C)C(=O)C9=CC=CC=C9)OC |
| Synonyms | CGP 41251, PKC412, PKC-412, CGP41251, CGP-41251 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 90 mg/mL (157.72 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 18 mg/mL | ||
| In vivo | 5% DMSO+45% PEG 300+ddH2O | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.52 mL | 87.62 mL | 175.24 mL |
| 0.5 mM | 3.5 mL | 17.52 mL | 35.05 mL |
| 1 mM | 1.75 mL | 8.76 mL | 17.52 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
